C13H19NO4 — CID 82722356
1-(1,3-benzodioxol-5-yl)-2-(2-methylpropoxyamino)ethanol (PubChem CID 82722356) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2-methylpropoxyamino)ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2-methylpropoxyamino)ethanol |
|---|---|
| PubChem CID | 82722356 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2-methylpropoxyamino)ethanol |
| SMILES | CC(C)CONCC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19NO4/c1-9(2)7-18-14-6-11(15)10-3-4-12-13(5-10)17-8-16-12/h3-5,9,11,14-15H,6-8H2,1-2H3 |
| InChIKey | JKSFQWKNUYPBJC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|