C13H19NO4 — CID 83176928
3-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]butan-1-ol (PubChem CID 83176928) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]butan-1-ol.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]butan-1-ol |
|---|---|
| PubChem CID | 83176928 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]butan-1-ol |
| SMILES | CC(CCO)NCC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19NO4/c1-9(4-5-15)14-7-11(16)10-2-3-12-13(6-10)18-8-17-12/h2-3,6,9,11,14-16H,4-5,7-8H2,1H3 |
| InChIKey | MJMHWUBXIZVRBS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |