C15H23NO4 — CID 107851558
6-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]hexan-1-ol (PubChem CID 107851558) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 6-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]hexan-1-ol.
| Compound Name | 6-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]hexan-1-ol |
|---|---|
| PubChem CID | 107851558 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 6-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]hexan-1-ol |
| SMILES | OCCCCCCNCC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H23NO4/c17-8-4-2-1-3-7-16-10-13(18)12-5-6-14-15(9-12)20-11-19-14/h5-6,9,13,16-18H,1-4,7-8,10-11H2 |
| InChIKey | OGDIMNCOEIPVQX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|