C13H18N2O5 — CID 106237685
2-[2-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]ethoxy]acetamide (PubChem CID 106237685) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[2-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]ethoxy]acetamide.
| Compound Name | 2-[2-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106237685 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[2-[[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]amino]ethoxy]acetamide |
| SMILES | NC(=O)COCCNCC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H18N2O5/c14-13(17)7-18-4-3-15-6-10(16)9-1-2-11-12(5-9)20-8-19-11/h1-2,5,10,15-16H,3-4,6-8H2,(H2,14,17) |
| InChIKey | NQARIAMOBKHBTQ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|