C9H11NO4 — CID 82112199
2-aminooxy-1-(1,3-benzodioxol-5-yl)ethanol (PubChem CID 82112199) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-aminooxy-1-(1,3-benzodioxol-5-yl)ethanol.
| Compound Name | 2-aminooxy-1-(1,3-benzodioxol-5-yl)ethanol |
|---|---|
| PubChem CID | 82112199 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-aminooxy-1-(1,3-benzodioxol-5-yl)ethanol |
| SMILES | NOCC(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H11NO4/c10-14-4-7(11)6-1-2-8-9(3-6)13-5-12-8/h1-3,7,11H,4-5,10H2 |
| InChIKey | AJDUQWFUVSAAKY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|