C9H9ClO3 — CID 93182688
(1R)-1-(1,3-benzodioxol-5-yl)-2-chloroethanol (PubChem CID 93182688) has the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. Its IUPAC name is (1R)-1-(1,3-benzodioxol-5-yl)-2-chloroethanol.
| Compound Name | (1R)-1-(1,3-benzodioxol-5-yl)-2-chloroethanol |
|---|---|
| PubChem CID | 93182688 |
| Molecular Formula | C9H9ClO3 |
| Molecular Weight | 200.62 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | (1R)-1-(1,3-benzodioxol-5-yl)-2-chloroethanol |
| SMILES | O[C@@H](CCl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H9ClO3/c10-4-7(11)6-1-2-8-9(3-6)13-5-12-8/h1-3,7,11H,4-5H2/t7-/m0/s1 |
| InChIKey | YWPJZZBYTIRESV-ZETCQYMHSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.62 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|