C15H12Cl2O3 — CID 107307427
1-(1,3-benzodioxol-5-yl)-2-(2,3-dichlorophenyl)ethanol (PubChem CID 107307427) has the molecular formula C15H12Cl2O3 and a molecular weight of 311.16 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2,3-dichlorophenyl)ethanol.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2,3-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 107307427 |
| Molecular Formula | C15H12Cl2O3 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2,3-dichlorophenyl)ethanol |
| SMILES | OC(Cc1cccc(Cl)c1Cl)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12Cl2O3/c16-11-3-1-2-10(15(11)17)6-12(18)9-4-5-13-14(7-9)20-8-19-13/h1-5,7,12,18H,6,8H2 |
| InChIKey | YNKOKXNKXGIYET-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |