C15H12Cl2F2O2 — CID 107312488
2-(2,3-dichlorophenyl)-1-[3-(difluoromethoxy)phenyl]ethanol (PubChem CID 107312488) has the molecular formula C15H12Cl2F2O2 and a molecular weight of 333.16 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-1-[3-(difluoromethoxy)phenyl]ethanol.
| Compound Name | 2-(2,3-dichlorophenyl)-1-[3-(difluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 107312488 |
| Molecular Formula | C15H12Cl2F2O2 |
| Molecular Weight | 333.16 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-1-[3-(difluoromethoxy)phenyl]ethanol |
| SMILES | OC(Cc1cccc(Cl)c1Cl)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H12Cl2F2O2/c16-12-6-2-4-10(14(12)17)8-13(20)9-3-1-5-11(7-9)21-15(18)19/h1-7,13,15,20H,8H2 |
| InChIKey | SXGWNTDPSPGSFY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.16 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |