C15H13BrCl2O — CID 107307685
1-(3-bromo-4-methylphenyl)-2-(2,3-dichlorophenyl)ethanol (PubChem CID 107307685) has the molecular formula C15H13BrCl2O and a molecular weight of 360.08 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-2-(2,3-dichlorophenyl)ethanol.
| Compound Name | 1-(3-bromo-4-methylphenyl)-2-(2,3-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 107307685 |
| Molecular Formula | C15H13BrCl2O |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-2-(2,3-dichlorophenyl)ethanol |
| SMILES | Cc1ccc(C(O)Cc2cccc(Cl)c2Cl)cc1Br |
| InChI | InChI=1S/C15H13BrCl2O/c1-9-5-6-10(7-12(9)16)14(19)8-11-3-2-4-13(17)15(11)18/h2-7,14,19H,8H2,1H3 |
| InChIKey | XNTFHZIDKYBKHD-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |