C17H18Cl2O2 — CID 65145651
2-(2,6-dichlorophenyl)-1-(3-propan-2-yloxyphenyl)ethanol (PubChem CID 65145651) has the molecular formula C17H18Cl2O2 and a molecular weight of 325.24 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(3-propan-2-yloxyphenyl)ethanol.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(3-propan-2-yloxyphenyl)ethanol |
|---|---|
| PubChem CID | 65145651 |
| Molecular Formula | C17H18Cl2O2 |
| Molecular Weight | 325.24 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(3-propan-2-yloxyphenyl)ethanol |
| SMILES | CC(C)Oc1cccc(C(O)Cc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C17H18Cl2O2/c1-11(2)21-13-6-3-5-12(9-13)17(20)10-14-15(18)7-4-8-16(14)19/h3-9,11,17,20H,10H2,1-2H3 |
| InChIKey | TVOHHYPWQMOICG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |