C14H10Cl2O3 — CID 61082396
1,3-benzodioxol-5-yl-(3,4-dichlorophenyl)methanol (PubChem CID 61082396) has the molecular formula C14H10Cl2O3 and a molecular weight of 297.14 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(3,4-dichlorophenyl)methanol.
| Compound Name | 1,3-benzodioxol-5-yl-(3,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 61082396 |
| Molecular Formula | C14H10Cl2O3 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(3,4-dichlorophenyl)methanol |
| SMILES | OC(c1ccc(Cl)c(Cl)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H10Cl2O3/c15-10-3-1-8(5-11(10)16)14(17)9-2-4-12-13(6-9)19-7-18-12/h1-6,14,17H,7H2 |
| InChIKey | BNHDFFDXQKBADT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |