C11H16O3Si — CID 12705761
1,3-benzodioxol-5-yl(trimethylsilyl)methanol (PubChem CID 12705761) has the molecular formula C11H16O3Si and a molecular weight of 224.33 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl(trimethylsilyl)methanol.
| Compound Name | 1,3-benzodioxol-5-yl(trimethylsilyl)methanol |
|---|---|
| PubChem CID | 12705761 |
| Molecular Formula | C11H16O3Si |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 1,3-benzodioxol-5-yl(trimethylsilyl)methanol |
| SMILES | C[Si](C)(C)C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H16O3Si/c1-15(2,3)11(12)8-4-5-9-10(6-8)14-7-13-9/h4-6,11-12H,7H2,1-3H3 |
| InChIKey | SYOUATGBWQPTMO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|