C20H30O3Si3 — CID 23583843
1,3-benzodioxol-5-yl-[phenyl-bis(trimethylsilyl)silyl]methanol (PubChem CID 23583843) has the molecular formula C20H30O3Si3 and a molecular weight of 402.72 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[phenyl-bis(trimethylsilyl)silyl]methanol.
| Compound Name | 1,3-benzodioxol-5-yl-[phenyl-bis(trimethylsilyl)silyl]methanol |
|---|---|
| PubChem CID | 23583843 |
| Molecular Formula | C20H30O3Si3 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[phenyl-bis(trimethylsilyl)silyl]methanol |
| SMILES | C[Si](C)(C)[Si](c1ccccc1)(C(O)c1ccc2c(c1)OCO2)[Si](C)(C)C |
| InChI | InChI=1S/C20H30O3Si3/c1-24(2,3)26(25(4,5)6,17-10-8-7-9-11-17)20(21)16-12-13-18-19(14-16)23-15-22-18/h7-14,20-21H,15H2,1-6H3 |
| InChIKey | UIBNGBQBSUZCKY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|