C20H17O4P — CID 1000311
(S)-1,3-benzodioxol-5-yl(diphenylphosphoryl)methanol (PubChem CID 1000311) has the molecular formula C20H17O4P and a molecular weight of 352.33 g/mol. Its IUPAC name is (S)-1,3-benzodioxol-5-yl(diphenylphosphoryl)methanol.
| Compound Name | (S)-1,3-benzodioxol-5-yl(diphenylphosphoryl)methanol |
|---|---|
| PubChem CID | 1000311 |
| Molecular Formula | C20H17O4P |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (S)-1,3-benzodioxol-5-yl(diphenylphosphoryl)methanol |
| SMILES | O=P(c1ccccc1)(c1ccccc1)[C@H](O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H17O4P/c21-20(15-11-12-18-19(13-15)24-14-23-18)25(22,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,20-21H,14H2/t20-/m0/s1 |
| InChIKey | NZQPYVLMEYQPGN-FQEVSTJZSA-N |
| XLogP | 3.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|