C32H27NO4P2 — CID 12018362
1-(1,3-benzodioxol-5-yl)-N,1-bis(diphenylphosphoryl)methanamine (PubChem CID 12018362) has the molecular formula C32H27NO4P2 and a molecular weight of 551.52 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N,1-bis(diphenylphosphoryl)methanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N,1-bis(diphenylphosphoryl)methanamine |
|---|---|
| PubChem CID | 12018362 |
| Molecular Formula | C32H27NO4P2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N,1-bis(diphenylphosphoryl)methanamine |
| SMILES | O=P(NC(c1ccc2c(c1)OCO2)P(=O)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H27NO4P2/c34-38(26-13-5-1-6-14-26,27-15-7-2-8-16-27)32(25-21-22-30-31(23-25)37-24-36-30)33-39(35,28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-23,32H,24H2,(H,33,35) |
| InChIKey | FMEQOJNNUASAHP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|