C24H20NO3PS — CID 134103675
N-[diphenylphosphoryl(thiophen-2-yl)methyl]-1,3-benzodioxol-5-amine (PubChem CID 134103675) has the molecular formula C24H20NO3PS and a molecular weight of 433.47 g/mol. Its IUPAC name is N-[diphenylphosphoryl(thiophen-2-yl)methyl]-1,3-benzodioxol-5-amine.
| Compound Name | N-[diphenylphosphoryl(thiophen-2-yl)methyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 134103675 |
| Molecular Formula | C24H20NO3PS |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-[diphenylphosphoryl(thiophen-2-yl)methyl]-1,3-benzodioxol-5-amine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)C(Nc1ccc2c(c1)OCO2)c1cccs1 |
| InChI | InChI=1S/C24H20NO3PS/c26-29(19-8-3-1-4-9-19,20-10-5-2-6-11-20)24(23-12-7-15-30-23)25-18-13-14-21-22(16-18)28-17-27-21/h1-16,24-25H,17H2 |
| InChIKey | IMEUXWLZZNTHAN-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|