C19H20N2O3 — CID 41119455
(2S)-2-(1,3-benzodioxol-5-ylamino)-2-phenyl-1-pyrrolidin-1-ylethanone (PubChem CID 41119455) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-ylamino)-2-phenyl-1-pyrrolidin-1-ylethanone.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-2-phenyl-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 41119455 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-2-phenyl-1-pyrrolidin-1-ylethanone |
| SMILES | O=C([C@@H](Nc1ccc2c(c1)OCO2)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C19H20N2O3/c22-19(21-10-4-5-11-21)18(14-6-2-1-3-7-14)20-15-8-9-16-17(12-15)24-13-23-16/h1-3,6-9,12,18,20H,4-5,10-11,13H2/t18-/m0/s1 |
| InChIKey | CQTYYGXBWCOZMA-SFHVURJKSA-N |
| XLogP | 3.19 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|