C19H17N3O4 — CID 40791076
(2S)-2-(1,3-benzodioxol-5-ylamino)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide (PubChem CID 40791076) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 40791076 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylacetamide |
| SMILES | Cc1cc(NC(=O)[C@@H](Nc2ccc3c(c2)OCO3)c2ccccc2)no1 |
| InChI | InChI=1S/C19H17N3O4/c1-12-9-17(22-26-12)21-19(23)18(13-5-3-2-4-6-13)20-14-7-8-15-16(10-14)25-11-24-15/h2-10,18,20H,11H2,1H3,(H,21,22,23)/t18-/m0/s1 |
| InChIKey | GAWSAXAUJAVJGH-SFHVURJKSA-N |
| XLogP | 3.50 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|