C22H19ClN2O4 — CID 2471699
(2S)-2-(1,3-benzodioxol-5-ylamino)-N-(3-chloro-4-methoxyphenyl)-2-phenylacetamide (PubChem CID 2471699) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(3-chloro-4-methoxyphenyl)-2-phenylacetamide.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(3-chloro-4-methoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 2471699 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-(3-chloro-4-methoxyphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(NC(=O)[C@@H](Nc2ccc3c(c2)OCO3)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H19ClN2O4/c1-27-18-9-7-15(11-17(18)23)25-22(26)21(14-5-3-2-4-6-14)24-16-8-10-19-20(12-16)29-13-28-19/h2-12,21,24H,13H2,1H3,(H,25,26)/t21-/m0/s1 |
| InChIKey | YRWRXVKWBMBPIO-NRFANRHFSA-N |
| XLogP | 4.87 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|