C16H13ClN2O5 — CID 87890643
N-(1,3-benzodioxol-5-yl)-N-[(3-chloro-4-methoxyphenyl)carbamoyl]formamide (PubChem CID 87890643) has the molecular formula C16H13ClN2O5 and a molecular weight of 348.74 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-[(3-chloro-4-methoxyphenyl)carbamoyl]formamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-[(3-chloro-4-methoxyphenyl)carbamoyl]formamide |
|---|---|
| PubChem CID | 87890643 |
| Molecular Formula | C16H13ClN2O5 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-[(3-chloro-4-methoxyphenyl)carbamoyl]formamide |
| SMILES | COc1ccc(NC(=O)N(C=O)c2ccc3c(c2)OCO3)cc1Cl |
| InChI | InChI=1S/C16H13ClN2O5/c1-22-13-4-2-10(6-12(13)17)18-16(21)19(8-20)11-3-5-14-15(7-11)24-9-23-14/h2-8H,9H2,1H3,(H,18,21) |
| InChIKey | IGAGHJVXEJDFJI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|