C16H10F4N2O4 — CID 22245951
N-(1,3-benzodioxol-5-ylcarbamoyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]formamide (PubChem CID 22245951) has the molecular formula C16H10F4N2O4 and a molecular weight of 370.26 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylcarbamoyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]formamide.
| Compound Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]formamide |
|---|---|
| PubChem CID | 22245951 |
| Molecular Formula | C16H10F4N2O4 |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylcarbamoyl)-N-[4-fluoro-3-(trifluoromethyl)phenyl]formamide |
| SMILES | O=CN(C(=O)Nc1ccc2c(c1)OCO2)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H10F4N2O4/c17-12-3-2-10(6-11(12)16(18,19)20)22(7-23)15(24)21-9-1-4-13-14(5-9)26-8-25-13/h1-7H,8H2,(H,21,24) |
| InChIKey | CSSLKUVSTAUJIS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|