C15H10F2N2O4 — CID 87890470
N-(1,3-benzodioxol-5-yl)-N-[(2,6-difluorophenyl)carbamoyl]formamide (PubChem CID 87890470) has the molecular formula C15H10F2N2O4 and a molecular weight of 320.25 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-[(2,6-difluorophenyl)carbamoyl]formamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-[(2,6-difluorophenyl)carbamoyl]formamide |
|---|---|
| PubChem CID | 87890470 |
| Molecular Formula | C15H10F2N2O4 |
| Molecular Weight | 320.25 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-[(2,6-difluorophenyl)carbamoyl]formamide |
| SMILES | O=CN(C(=O)Nc1c(F)cccc1F)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H10F2N2O4/c16-10-2-1-3-11(17)14(10)18-15(21)19(7-20)9-4-5-12-13(6-9)23-8-22-12/h1-7H,8H2,(H,18,21) |
| InChIKey | ZXWNDVYDVQNWQR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|