C16H11F3N2O4S — CID 87890265
N-(1,3-benzodioxol-5-yl)-N-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]formamide (PubChem CID 87890265) has the molecular formula C16H11F3N2O4S and a molecular weight of 384.34 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]formamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]formamide |
|---|---|
| PubChem CID | 87890265 |
| Molecular Formula | C16H11F3N2O4S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-[[3-(trifluoromethylsulfanyl)phenyl]carbamoyl]formamide |
| SMILES | O=CN(C(=O)Nc1cccc(SC(F)(F)F)c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H11F3N2O4S/c17-16(18,19)26-12-3-1-2-10(6-12)20-15(23)21(8-22)11-4-5-13-14(7-11)25-9-24-13/h1-8H,9H2,(H,20,23) |
| InChIKey | UDGHBDODWXMOLP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|