C16H12N2O6 — CID 87890859
N-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylcarbamoyl)formamide (PubChem CID 87890859) has the molecular formula C16H12N2O6 and a molecular weight of 328.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylcarbamoyl)formamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylcarbamoyl)formamide |
|---|---|
| PubChem CID | 87890859 |
| Molecular Formula | C16H12N2O6 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylcarbamoyl)formamide |
| SMILES | O=CN(C(=O)Nc1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H12N2O6/c19-7-18(11-2-4-13-15(6-11)24-9-22-13)16(20)17-10-1-3-12-14(5-10)23-8-21-12/h1-7H,8-9H2,(H,17,20) |
| InChIKey | OIERQBDHUCZGHS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|