C17H14ClF3N4O2 — CID 141055660
N-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-N-(1,2,3,4-tetrahydroquinoxalin-6-yl)formamide (PubChem CID 141055660) has the molecular formula C17H14ClF3N4O2 and a molecular weight of 398.77 g/mol. Its IUPAC name is N-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-N-(1,2,3,4-tetrahydroquinoxalin-6-yl)formamide.
| Compound Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-N-(1,2,3,4-tetrahydroquinoxalin-6-yl)formamide |
|---|---|
| PubChem CID | 141055660 |
| Molecular Formula | C17H14ClF3N4O2 |
| Molecular Weight | 398.77 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoyl]-N-(1,2,3,4-tetrahydroquinoxalin-6-yl)formamide |
| SMILES | O=CN(C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccc2c(c1)NCCN2 |
| InChI | InChI=1S/C17H14ClF3N4O2/c18-13-3-1-10(7-12(13)17(19,20)21)24-16(27)25(9-26)11-2-4-14-15(8-11)23-6-5-22-14/h1-4,7-9,22-23H,5-6H2,(H,24,27) |
| InChIKey | GUAWVVITQPNZRL-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|