C15H9ClF6N2O — CID 154269683
3-[4-chloro-3-(trifluoromethyl)phenyl]-1-phenyl-1-(trifluoromethyl)urea (PubChem CID 154269683) has the molecular formula C15H9ClF6N2O and a molecular weight of 382.69 g/mol. Its IUPAC name is 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-phenyl-1-(trifluoromethyl)urea.
| Compound Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-phenyl-1-(trifluoromethyl)urea |
|---|---|
| PubChem CID | 154269683 |
| Molecular Formula | C15H9ClF6N2O |
| Molecular Weight | 382.69 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 3-[4-chloro-3-(trifluoromethyl)phenyl]-1-phenyl-1-(trifluoromethyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)N(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H9ClF6N2O/c16-12-7-6-9(8-11(12)14(17,18)19)23-13(25)24(15(20,21)22)10-4-2-1-3-5-10/h1-8H,(H,23,25) |
| InChIKey | AOBYZHRNQGYHEC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.69 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|