C21H13ClF3NO2 — CID 3949340
N-[4-chloro-3-(trifluoromethyl)phenyl]-9H-xanthene-9-carboxamide (PubChem CID 3949340) has the molecular formula C21H13ClF3NO2 and a molecular weight of 403.79 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-9H-xanthene-9-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 3949340 |
| Molecular Formula | C21H13ClF3NO2 |
| Molecular Weight | 403.79 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-9H-xanthene-9-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C21H13ClF3NO2/c22-16-10-9-12(11-15(16)21(23,24)25)26-20(27)19-13-5-1-3-7-17(13)28-18-8-4-2-6-14(18)19/h1-11,19H,(H,26,27) |
| InChIKey | XBMFCWYYYPKWQK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.79 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |