C23H20ClN3O5 — CID 4792726
2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-N-(3-chloro-4-methoxyphenyl)-2-phenylacetamide (PubChem CID 4792726) has the molecular formula C23H20ClN3O5 and a molecular weight of 453.88 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-N-(3-chloro-4-methoxyphenyl)-2-phenylacetamide.
| Compound Name | 2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-N-(3-chloro-4-methoxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 4792726 |
| Molecular Formula | C23H20ClN3O5 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-N-(3-chloro-4-methoxyphenyl)-2-phenylacetamide |
| SMILES | COc1ccc(NC(=O)C(NNC(=O)c2ccc3c(c2)OCO3)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C23H20ClN3O5/c1-30-18-10-8-16(12-17(18)24)25-23(29)21(14-5-3-2-4-6-14)26-27-22(28)15-7-9-19-20(11-15)32-13-31-19/h2-12,21,26H,13H2,1H3,(H,25,29)(H,27,28) |
| InChIKey | SITMKAOXZLNJMJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|