C23H21N3O4 — CID 8761063
(2R)-2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-N-(4-methylphenyl)-2-phenylacetamide (PubChem CID 8761063) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is (2R)-2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-N-(4-methylphenyl)-2-phenylacetamide.
| Compound Name | (2R)-2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-N-(4-methylphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 8761063 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (2R)-2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-N-(4-methylphenyl)-2-phenylacetamide |
| SMILES | Cc1ccc(NC(=O)[C@H](NNC(=O)c2ccc3c(c2)OCO3)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c1-15-7-10-18(11-8-15)24-23(28)21(16-5-3-2-4-6-16)25-26-22(27)17-9-12-19-20(13-17)30-14-29-19/h2-13,21,25H,14H2,1H3,(H,24,28)(H,26,27)/t21-/m1/s1 |
| InChIKey | XROHFVBZPPOOSK-OAQYLSRUSA-N |
| XLogP | 3.34 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|