C21H17N3O5S — CID 31057380
N-[(1S)-2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-2-oxo-1-phenylethyl]thiophene-2-carboxamide (PubChem CID 31057380) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is N-[(1S)-2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-2-oxo-1-phenylethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1S)-2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-2-oxo-1-phenylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 31057380 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[(1S)-2-[2-(1,3-benzodioxole-5-carbonyl)hydrazinyl]-2-oxo-1-phenylethyl]thiophene-2-carboxamide |
| SMILES | O=C(NNC(=O)[C@@H](NC(=O)c1cccs1)c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H17N3O5S/c25-19(14-8-9-15-16(11-14)29-12-28-15)23-24-21(27)18(13-5-2-1-3-6-13)22-20(26)17-7-4-10-30-17/h1-11,18H,12H2,(H,22,26)(H,23,25)(H,24,27)/t18-/m0/s1 |
| InChIKey | RDOLKCHEFOZIMM-SFHVURJKSA-N |
| XLogP | 2.41 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|