C24H27N3O3S — CID 31057394
N-[(1S)-2-[2-(adamantane-1-carbonyl)hydrazinyl]-2-oxo-1-phenylethyl]thiophene-2-carboxamide (PubChem CID 31057394) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[(1S)-2-[2-(adamantane-1-carbonyl)hydrazinyl]-2-oxo-1-phenylethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1S)-2-[2-(adamantane-1-carbonyl)hydrazinyl]-2-oxo-1-phenylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 31057394 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | N-[(1S)-2-[2-(adamantane-1-carbonyl)hydrazinyl]-2-oxo-1-phenylethyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H](C(=O)NNC(=O)C12CC3CC(CC(C3)C1)C2)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C24H27N3O3S/c28-21(19-7-4-8-31-19)25-20(18-5-2-1-3-6-18)22(29)26-27-23(30)24-12-15-9-16(13-24)11-17(10-15)14-24/h1-8,15-17,20H,9-14H2,(H,25,28)(H,26,29)(H,27,30)/t15?,16?,17?,20-,24?/m0/s1 |
| InChIKey | YCRVSYGNBZMNJN-ZDCBYCKXSA-N |
| XLogP | 3.58 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|