C16H14N4O2S — CID 95331365
N-[(1S)-2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]thiophene-2-carboxamide (PubChem CID 95331365) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[(1S)-2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[(1S)-2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 95331365 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[(1S)-2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@H](C(=O)Nc1ccn[nH]1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C16H14N4O2S/c21-15(12-7-4-10-23-12)19-14(11-5-2-1-3-6-11)16(22)18-13-8-9-17-20-13/h1-10,14H,(H,19,21)(H2,17,18,20,22)/t14-/m0/s1 |
| InChIKey | QLWXYLAGLHCCBP-AWEZNQCLSA-N |
| XLogP | 2.58 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |