C14H12F4N4O2 — CID 124609043
2,2,3,3-tetrafluoro-N-[(1S)-2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]propanamide (PubChem CID 124609043) has the molecular formula C14H12F4N4O2 and a molecular weight of 344.27 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-[(1S)-2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-[(1S)-2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 124609043 |
| Molecular Formula | C14H12F4N4O2 |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-[(1S)-2-oxo-1-phenyl-2-(1H-pyrazol-5-ylamino)ethyl]propanamide |
| SMILES | O=C(Nc1ccn[nH]1)[C@@H](NC(=O)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H12F4N4O2/c15-12(16)14(17,18)13(24)21-10(8-4-2-1-3-5-8)11(23)20-9-6-7-19-22-9/h1-7,10,12H,(H,21,24)(H2,19,20,22,23)/t10-/m0/s1 |
| InChIKey | MBTPKNXWPVBTBD-JTQLQIEISA-N |
| XLogP | 2.11 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|