C14H17F4NO — CID 103733000
N-(2,2-dimethyl-1-phenylpropyl)-2,2,3,3-tetrafluoropropanamide (PubChem CID 103733000) has the molecular formula C14H17F4NO and a molecular weight of 291.29 g/mol. Its IUPAC name is N-(2,2-dimethyl-1-phenylpropyl)-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(2,2-dimethyl-1-phenylpropyl)-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103733000 |
| Molecular Formula | C14H17F4NO |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-(2,2-dimethyl-1-phenylpropyl)-2,2,3,3-tetrafluoropropanamide |
| SMILES | CC(C)(C)C(NC(=O)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H17F4NO/c1-13(2,3)10(9-7-5-4-6-8-9)19-12(20)14(17,18)11(15)16/h4-8,10-11H,1-3H3,(H,19,20) |
| InChIKey | OOJJHYQBRHOOCV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|