C13H16F3NO — CID 11097278
N-[(1S)-2,2-dimethyl-1-phenylpropyl]-2,2,2-trifluoroacetamide (PubChem CID 11097278) has the molecular formula C13H16F3NO and a molecular weight of 259.27 g/mol. Its IUPAC name is N-[(1S)-2,2-dimethyl-1-phenylpropyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S)-2,2-dimethyl-1-phenylpropyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 11097278 |
| Molecular Formula | C13H16F3NO |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[(1S)-2,2-dimethyl-1-phenylpropyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H16F3NO/c1-12(2,3)10(9-7-5-4-6-8-9)17-11(18)13(14,15)16/h4-8,10H,1-3H3,(H,17,18)/t10-/m1/s1 |
| InChIKey | UXSPAZNGBSXXNG-SNVBAGLBSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |