C25H26N2O3 — CID 141117189
N'-[(1R)-2-hydroxy-1,2,2-triphenylethyl]-2,2-dimethylpropanediamide (PubChem CID 141117189) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is N'-[(1R)-2-hydroxy-1,2,2-triphenylethyl]-2,2-dimethylpropanediamide.
| Compound Name | N'-[(1R)-2-hydroxy-1,2,2-triphenylethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 141117189 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N'-[(1R)-2-hydroxy-1,2,2-triphenylethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(N)=O)C(=O)N[C@H](c1ccccc1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O3/c1-24(2,22(26)28)23(29)27-21(18-12-6-3-7-13-18)25(30,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17,21,30H,1-2H3,(H2,26,28)(H,27,29)/t21-/m1/s1 |
| InChIKey | KFSYGMQUGVTMDN-OAQYLSRUSA-N |
| XLogP | 3.29 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|