C44H36N2O4 — CID 11308302
3,4-bis[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 11308302) has the molecular formula C44H36N2O4 and a molecular weight of 656.78 g/mol. Its IUPAC name is 3,4-bis[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11308302 |
| Molecular Formula | C44H36N2O4 |
| Molecular Weight | 656.78 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 3,4-bis[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)c(N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)c1=O |
| InChI | InChI=1S/C44H36N2O4/c47-39-37(45-41(31-19-7-1-8-20-31)43(49,33-23-11-3-12-24-33)34-25-13-4-14-26-34)38(40(39)48)46-42(32-21-9-2-10-22-32)44(50,35-27-15-5-16-28-35)36-29-17-6-18-30-36/h1-30,41-42,45-46,49-50H/t41-,42-/m1/s1 |
| InChIKey | OHELLGGDZZRSLJ-NCRNUEESSA-N |
| XLogP | 7.46 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.78 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|