C10H8F5NO2 — CID 57302331
(2,2,3,3,3-pentafluoro-1-phenylpropyl)carbamic acid (PubChem CID 57302331) has the molecular formula C10H8F5NO2 and a molecular weight of 269.17 g/mol. Its IUPAC name is (2,2,3,3,3-pentafluoro-1-phenylpropyl)carbamic acid.
| Compound Name | (2,2,3,3,3-pentafluoro-1-phenylpropyl)carbamic acid |
|---|---|
| PubChem CID | 57302331 |
| Molecular Formula | C10H8F5NO2 |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | (2,2,3,3,3-pentafluoro-1-phenylpropyl)carbamic acid |
| SMILES | O=C(O)NC(c1ccccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H8F5NO2/c11-9(12,10(13,14)15)7(16-8(17)18)6-4-2-1-3-5-6/h1-5,7,16H,(H,17,18) |
| InChIKey | OSEYKUAKJLDBLL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|