C15H10Cl2F3NO — CID 142643393
2,6-dichloro-N-(2,2,2-trifluoro-1-phenylethyl)benzamide (PubChem CID 142643393) has the molecular formula C15H10Cl2F3NO and a molecular weight of 348.15 g/mol. Its IUPAC name is 2,6-dichloro-N-(2,2,2-trifluoro-1-phenylethyl)benzamide.
| Compound Name | 2,6-dichloro-N-(2,2,2-trifluoro-1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 142643393 |
| Molecular Formula | C15H10Cl2F3NO |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 2,6-dichloro-N-(2,2,2-trifluoro-1-phenylethyl)benzamide |
| SMILES | O=C(NC(c1ccccc1)C(F)(F)F)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H10Cl2F3NO/c16-10-7-4-8-11(17)12(10)14(22)21-13(15(18,19)20)9-5-2-1-3-6-9/h1-8,13H,(H,21,22) |
| InChIKey | TZCDAFPLSOOXLY-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |