C24H23Cl2N3O2 — CID 139505626
N-[1-(benzhydrylcarbamoylamino)propan-2-yl]-2,6-dichlorobenzamide (PubChem CID 139505626) has the molecular formula C24H23Cl2N3O2 and a molecular weight of 456.37 g/mol. Its IUPAC name is N-[1-(benzhydrylcarbamoylamino)propan-2-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[1-(benzhydrylcarbamoylamino)propan-2-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 139505626 |
| Molecular Formula | C24H23Cl2N3O2 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N-[1-(benzhydrylcarbamoylamino)propan-2-yl]-2,6-dichlorobenzamide |
| SMILES | CC(CNC(=O)NC(c1ccccc1)c1ccccc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O2/c1-16(28-23(30)21-19(25)13-8-14-20(21)26)15-27-24(31)29-22(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-14,16,22H,15H2,1H3,(H,28,30)(H2,27,29,31) |
| InChIKey | VHGOHIPAAMZXLN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |