C11H7Cl5N4O — CID 70540880
2,6-dichloro-N-[2,2,2-trichloro-1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide (PubChem CID 70540880) has the molecular formula C11H7Cl5N4O and a molecular weight of 388.47 g/mol. Its IUPAC name is 2,6-dichloro-N-[2,2,2-trichloro-1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide.
| Compound Name | 2,6-dichloro-N-[2,2,2-trichloro-1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 70540880 |
| Molecular Formula | C11H7Cl5N4O |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 385.91 |
| IUPAC Name | 2,6-dichloro-N-[2,2,2-trichloro-1-(1H-1,2,4-triazol-5-yl)ethyl]benzamide |
| SMILES | O=C(NC(c1ncn[nH]1)C(Cl)(Cl)Cl)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H7Cl5N4O/c12-5-2-1-3-6(13)7(5)10(21)19-8(11(14,15)16)9-17-4-18-20-9/h1-4,8H,(H,19,21)(H,17,18,20) |
| InChIKey | OLBIVHHKYQHILR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|