C14H18F3NO — CID 52652867
4-methyl-N-[(1S)-2,2,2-trifluoro-1-phenylethyl]pentanamide (PubChem CID 52652867) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 4-methyl-N-[(1S)-2,2,2-trifluoro-1-phenylethyl]pentanamide.
| Compound Name | 4-methyl-N-[(1S)-2,2,2-trifluoro-1-phenylethyl]pentanamide |
|---|---|
| PubChem CID | 52652867 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 4-methyl-N-[(1S)-2,2,2-trifluoro-1-phenylethyl]pentanamide |
| SMILES | CC(C)CCC(=O)N[C@@H](c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO/c1-10(2)8-9-12(19)18-13(14(15,16)17)11-6-4-3-5-7-11/h3-7,10,13H,8-9H2,1-2H3,(H,18,19)/t13-/m0/s1 |
| InChIKey | BCUZSCZQWGPEHC-ZDUSSCGKSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |