C17H26F3N — CID 107814952
7-methyl-N-(2,2,2-trifluoro-1-phenylethyl)octan-1-amine (PubChem CID 107814952) has the molecular formula C17H26F3N and a molecular weight of 301.40 g/mol. Its IUPAC name is 7-methyl-N-(2,2,2-trifluoro-1-phenylethyl)octan-1-amine.
| Compound Name | 7-methyl-N-(2,2,2-trifluoro-1-phenylethyl)octan-1-amine |
|---|---|
| PubChem CID | 107814952 |
| Molecular Formula | C17H26F3N |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 7-methyl-N-(2,2,2-trifluoro-1-phenylethyl)octan-1-amine |
| SMILES | CC(C)CCCCCCNC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H26F3N/c1-14(2)10-6-3-4-9-13-21-16(17(18,19)20)15-11-7-5-8-12-15/h5,7-8,11-12,14,16,21H,3-4,6,9-10,13H2,1-2H3 |
| InChIKey | POYKWEMWLARXTP-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|