C27H38F3NO — CID 150410606
(2S,3S)-3-(10,10-diphenyldecylamino)-1,1,1-trifluoro-2-methylbutan-2-ol (PubChem CID 150410606) has the molecular formula C27H38F3NO and a molecular weight of 449.60 g/mol. Its IUPAC name is (2S,3S)-3-(10,10-diphenyldecylamino)-1,1,1-trifluoro-2-methylbutan-2-ol.
| Compound Name | (2S,3S)-3-(10,10-diphenyldecylamino)-1,1,1-trifluoro-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 150410606 |
| Molecular Formula | C27H38F3NO |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | (2S,3S)-3-(10,10-diphenyldecylamino)-1,1,1-trifluoro-2-methylbutan-2-ol |
| SMILES | C[C@H](NCCCCCCCCCC(c1ccccc1)c1ccccc1)[C@](C)(O)C(F)(F)F |
| InChI | InChI=1S/C27H38F3NO/c1-22(26(2,32)27(28,29)30)31-21-15-7-5-3-4-6-14-20-25(23-16-10-8-11-17-23)24-18-12-9-13-19-24/h8-13,16-19,22,25,31-32H,3-7,14-15,20-21H2,1-2H3/t22-,26-/m0/s1 |
| InChIKey | HFRWNKXTHWCEMV-NVQXNPDNSA-N |
| XLogP | 7.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|