C19H27N — CID 142989405
ethane;N-methyl-4,4-diphenylbutan-1-amine (PubChem CID 142989405) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is ethane;N-methyl-4,4-diphenylbutan-1-amine.
| Compound Name | ethane;N-methyl-4,4-diphenylbutan-1-amine |
|---|---|
| PubChem CID | 142989405 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | ethane;N-methyl-4,4-diphenylbutan-1-amine |
| SMILES | CC.CNCCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H21N.C2H6/c1-18-14-8-13-17(15-9-4-2-5-10-15)16-11-6-3-7-12-16;1-2/h2-7,9-12,17-18H,8,13-14H2,1H3;1-2H3 |
| InChIKey | ZRHKKEXDORQRRM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|