C16H20N2 — CID 143031126
1-(3,3-diphenylpropyl)-2-methylhydrazine (PubChem CID 143031126) has the molecular formula C16H20N2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-2-methylhydrazine.
| Compound Name | 1-(3,3-diphenylpropyl)-2-methylhydrazine |
|---|---|
| PubChem CID | 143031126 |
| Molecular Formula | C16H20N2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-2-methylhydrazine |
| SMILES | CNNCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2/c1-17-18-13-12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16-18H,12-13H2,1H3 |
| InChIKey | GXWAZDITDPHPLX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|