C16H20ClN — CID 21467371
N-methyl-3,3-diphenylpropan-1-amine;hydrochloride (PubChem CID 21467371) has the molecular formula C16H20ClN and a molecular weight of 261.80 g/mol. Its IUPAC name is N-methyl-3,3-diphenylpropan-1-amine;hydrochloride.
| Compound Name | N-methyl-3,3-diphenylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 21467371 |
| Molecular Formula | C16H20ClN |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-methyl-3,3-diphenylpropan-1-amine;hydrochloride |
| SMILES | CNCCC(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C16H19N.ClH/c1-17-13-12-16(14-8-4-2-5-9-14)15-10-6-3-7-11-15;/h2-11,16-17H,12-13H2,1H3;1H |
| InChIKey | ZRSBFNZFGANOFG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |