C19H23ClN2O — CID 25261735
3-(4-methoxy-1H-indol-6-yl)-N-methyl-3-phenylpropan-1-amine;hydrochloride (PubChem CID 25261735) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is 3-(4-methoxy-1H-indol-6-yl)-N-methyl-3-phenylpropan-1-amine;hydrochloride.
| Compound Name | 3-(4-methoxy-1H-indol-6-yl)-N-methyl-3-phenylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 25261735 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-(4-methoxy-1H-indol-6-yl)-N-methyl-3-phenylpropan-1-amine;hydrochloride |
| SMILES | CNCCC(c1ccccc1)c1cc(OC)c2cc[nH]c2c1.Cl |
| InChI | InChI=1S/C19H22N2O.ClH/c1-20-10-8-16(14-6-4-3-5-7-14)15-12-18-17(9-11-21-18)19(13-15)22-2;/h3-7,9,11-13,16,20-21H,8,10H2,1-2H3;1H |
| InChIKey | QERBKCCZDYJXBV-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |