C18H23N3O — CID 143475499
(4Z)-3-(4-methoxy-1H-indol-6-yl)-N-methyl-4-(methylideneamino)hepta-4,6-dien-1-amine (PubChem CID 143475499) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is (4Z)-3-(4-methoxy-1H-indol-6-yl)-N-methyl-4-(methylideneamino)hepta-4,6-dien-1-amine.
| Compound Name | (4Z)-3-(4-methoxy-1H-indol-6-yl)-N-methyl-4-(methylideneamino)hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 143475499 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | (4Z)-3-(4-methoxy-1H-indol-6-yl)-N-methyl-4-(methylideneamino)hepta-4,6-dien-1-amine |
| SMILES | C=C/C=C(\N=C)C(CCNC)c1cc(OC)c2cc[nH]c2c1 |
| InChI | InChI=1S/C18H23N3O/c1-5-6-16(20-3)14(7-9-19-2)13-11-17-15(8-10-21-17)18(12-13)22-4/h5-6,8,10-12,14,19,21H,1,3,7,9H2,2,4H3/b16-6- |
| InChIKey | DQUDZIJSEOYKPT-SOFYXZRVSA-N |
| XLogP | 3.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|