C19H23NOS — CID 89078713
(3S,4Z)-N-methyl-4-methylsulfanyl-3-naphthalen-1-yloxyhepta-4,6-dien-1-amine (PubChem CID 89078713) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is (3S,4Z)-N-methyl-4-methylsulfanyl-3-naphthalen-1-yloxyhepta-4,6-dien-1-amine.
| Compound Name | (3S,4Z)-N-methyl-4-methylsulfanyl-3-naphthalen-1-yloxyhepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 89078713 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (3S,4Z)-N-methyl-4-methylsulfanyl-3-naphthalen-1-yloxyhepta-4,6-dien-1-amine |
| SMILES | C=C/C=C(\SC)[C@H](CCNC)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C19H23NOS/c1-4-8-19(22-3)18(13-14-20-2)21-17-12-7-10-15-9-5-6-11-16(15)17/h4-12,18,20H,1,13-14H2,2-3H3/b19-8-/t18-/m0/s1 |
| InChIKey | JYPXPHYGWKFTRK-XJBHOSEGSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|